C13H23N3O4 — CID 107319254
2-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-(5-hydroxypentyl)acetamide (PubChem CID 107319254) has the molecular formula C13H23N3O4 and a molecular weight of 285.34 g/mol. Its IUPAC name is 2-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-(5-hydroxypentyl)acetamide.
| Compound Name | 2-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-(5-hydroxypentyl)acetamide |
|---|---|
| PubChem CID | 107319254 |
| Molecular Formula | C13H23N3O4 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 2-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-(5-hydroxypentyl)acetamide |
| SMILES | CCC1(C)NC(=O)N(CC(=O)NCCCCCO)C1=O |
| InChI | InChI=1S/C13H23N3O4/c1-3-13(2)11(19)16(12(20)15-13)9-10(18)14-7-5-4-6-8-17/h17H,3-9H2,1-2H3,(H,14,18)(H,15,20) |
| InChIKey | INOHOQSTRRTLDU-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|