C12H22N4O3 — CID 119408013
N-(3-aminopropyl)-2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetamide (PubChem CID 119408013) has the molecular formula C12H22N4O3 and a molecular weight of 270.33 g/mol. Its IUPAC name is N-(3-aminopropyl)-2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetamide.
| Compound Name | N-(3-aminopropyl)-2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 119408013 |
| Molecular Formula | C12H22N4O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | N-(3-aminopropyl)-2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetamide |
| SMILES | CCC1(CC)NC(=O)N(CC(=O)NCCCN)C1=O |
| InChI | InChI=1S/C12H22N4O3/c1-3-12(4-2)10(18)16(11(19)15-12)8-9(17)14-7-5-6-13/h3-8,13H2,1-2H3,(H,14,17)(H,15,19) |
| InChIKey | VMKTYNZRHUKKBM-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|