C19H28N4O5S — CID 55589191
2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]acetamide (PubChem CID 55589191) has the molecular formula C19H28N4O5S and a molecular weight of 424.52 g/mol. Its IUPAC name is 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]acetamide.
| Compound Name | 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 55589191 |
| Molecular Formula | C19H28N4O5S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]acetamide |
| SMILES | CCC1(CC)NC(=O)N(CC(=O)NCCNS(=O)(=O)c2cc(C)ccc2C)C1=O |
| InChI | InChI=1S/C19H28N4O5S/c1-5-19(6-2)17(25)23(18(26)22-19)12-16(24)20-9-10-21-29(27,28)15-11-13(3)7-8-14(15)4/h7-8,11,21H,5-6,9-10,12H2,1-4H3,(H,20,24)(H,22,26) |
| InChIKey | XPSDXOGUYFYHCX-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|