C22H29N3O4S2 — CID 46592950
N-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-2-[2-(4-methylanilino)-2-oxoethyl]sulfanylpropanamide (PubChem CID 46592950) has the molecular formula C22H29N3O4S2 and a molecular weight of 463.63 g/mol. Its IUPAC name is N-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-2-[2-(4-methylanilino)-2-oxoethyl]sulfanylpropanamide.
| Compound Name | N-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-2-[2-(4-methylanilino)-2-oxoethyl]sulfanylpropanamide |
|---|---|
| PubChem CID | 46592950 |
| Molecular Formula | C22H29N3O4S2 |
| Molecular Weight | 463.63 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | N-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-2-[2-(4-methylanilino)-2-oxoethyl]sulfanylpropanamide |
| SMILES | Cc1ccc(NC(=O)CSC(C)C(=O)NCCNS(=O)(=O)c2cc(C)ccc2C)cc1 |
| InChI | InChI=1S/C22H29N3O4S2/c1-15-6-9-19(10-7-15)25-21(26)14-30-18(4)22(27)23-11-12-24-31(28,29)20-13-16(2)5-8-17(20)3/h5-10,13,18,24H,11-12,14H2,1-4H3,(H,23,27)(H,25,26) |
| InChIKey | KODKKYXHIJSLES-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.63 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|