C20H24FN3O4S2 — CID 55546184
2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]propanamide (PubChem CID 55546184) has the molecular formula C20H24FN3O4S2 and a molecular weight of 453.56 g/mol. Its IUPAC name is 2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]propanamide.
| Compound Name | 2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]propanamide |
|---|---|
| PubChem CID | 55546184 |
| Molecular Formula | C20H24FN3O4S2 |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | 2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]propanamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCNC(=O)C(C)SCC(=O)Nc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C20H24FN3O4S2/c1-14-3-9-18(10-4-14)30(27,28)23-12-11-22-20(26)15(2)29-13-19(25)24-17-7-5-16(21)6-8-17/h3-10,15,23H,11-13H2,1-2H3,(H,22,26)(H,24,25) |
| InChIKey | NMJXZOJHSHIVCQ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|