C15H19FN2O4S — CID 82032997
4-[2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanoylamino]butanoic acid (PubChem CID 82032997) has the molecular formula C15H19FN2O4S and a molecular weight of 342.39 g/mol. Its IUPAC name is 4-[2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanoylamino]butanoic acid.
| Compound Name | 4-[2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanoylamino]butanoic acid |
|---|---|
| PubChem CID | 82032997 |
| Molecular Formula | C15H19FN2O4S |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 4-[2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanoylamino]butanoic acid |
| SMILES | CC(SCC(=O)Nc1ccc(F)cc1)C(=O)NCCCC(=O)O |
| InChI | InChI=1S/C15H19FN2O4S/c1-10(15(22)17-8-2-3-14(20)21)23-9-13(19)18-12-6-4-11(16)5-7-12/h4-7,10H,2-3,8-9H2,1H3,(H,17,22)(H,18,19)(H,20,21) |
| InChIKey | MVDQEVXUPZZEPQ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|