C17H16BrFN2O2S — CID 7730383
(2S)-N-(4-bromophenyl)-2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanamide (PubChem CID 7730383) has the molecular formula C17H16BrFN2O2S and a molecular weight of 411.30 g/mol. Its IUPAC name is (2S)-N-(4-bromophenyl)-2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanamide.
| Compound Name | (2S)-N-(4-bromophenyl)-2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanamide |
|---|---|
| PubChem CID | 7730383 |
| Molecular Formula | C17H16BrFN2O2S |
| Molecular Weight | 411.30 g/mol |
| Exact Mass | 410.01 |
| IUPAC Name | (2S)-N-(4-bromophenyl)-2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanamide |
| SMILES | C[C@H](SCC(=O)Nc1ccc(F)cc1)C(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C17H16BrFN2O2S/c1-11(17(23)21-15-6-2-12(18)3-7-15)24-10-16(22)20-14-8-4-13(19)5-9-14/h2-9,11H,10H2,1H3,(H,20,22)(H,21,23)/t11-/m0/s1 |
| InChIKey | VJRDBFPHBNLRAA-NSHDSACASA-N |
| XLogP | 4.29 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.30 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |