C21H25FN2O2S — CID 8779811
(2S)-N-(4-tert-butylphenyl)-2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanamide (PubChem CID 8779811) has the molecular formula C21H25FN2O2S and a molecular weight of 388.51 g/mol. Its IUPAC name is (2S)-N-(4-tert-butylphenyl)-2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanamide.
| Compound Name | (2S)-N-(4-tert-butylphenyl)-2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanamide |
|---|---|
| PubChem CID | 8779811 |
| Molecular Formula | C21H25FN2O2S |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | (2S)-N-(4-tert-butylphenyl)-2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanamide |
| SMILES | C[C@H](SCC(=O)Nc1ccc(F)cc1)C(=O)Nc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H25FN2O2S/c1-14(27-13-19(25)23-17-11-7-16(22)8-12-17)20(26)24-18-9-5-15(6-10-18)21(2,3)4/h5-12,14H,13H2,1-4H3,(H,23,25)(H,24,26)/t14-/m0/s1 |
| InChIKey | YXTQZDSHIXDGPU-AWEZNQCLSA-N |
| XLogP | 4.82 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |