C18H18ClFN2O2S — CID 7730363
(2S)-N-(3-chloro-4-methylphenyl)-2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanamide (PubChem CID 7730363) has the molecular formula C18H18ClFN2O2S and a molecular weight of 380.87 g/mol. Its IUPAC name is (2S)-N-(3-chloro-4-methylphenyl)-2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanamide.
| Compound Name | (2S)-N-(3-chloro-4-methylphenyl)-2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanamide |
|---|---|
| PubChem CID | 7730363 |
| Molecular Formula | C18H18ClFN2O2S |
| Molecular Weight | 380.87 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | (2S)-N-(3-chloro-4-methylphenyl)-2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanamide |
| SMILES | Cc1ccc(NC(=O)[C@H](C)SCC(=O)Nc2ccc(F)cc2)cc1Cl |
| InChI | InChI=1S/C18H18ClFN2O2S/c1-11-3-6-15(9-16(11)19)22-18(24)12(2)25-10-17(23)21-14-7-4-13(20)5-8-14/h3-9,12H,10H2,1-2H3,(H,21,23)(H,22,24)/t12-/m0/s1 |
| InChIKey | XRDGALKVYCMQAA-LBPRGKRZSA-N |
| XLogP | 4.49 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.87 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |