C20H22FN3O3S — CID 55787973
2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-N-[4-(propanoylamino)phenyl]propanamide (PubChem CID 55787973) has the molecular formula C20H22FN3O3S and a molecular weight of 403.48 g/mol. Its IUPAC name is 2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-N-[4-(propanoylamino)phenyl]propanamide.
| Compound Name | 2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-N-[4-(propanoylamino)phenyl]propanamide |
|---|---|
| PubChem CID | 55787973 |
| Molecular Formula | C20H22FN3O3S |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-N-[4-(propanoylamino)phenyl]propanamide |
| SMILES | CCC(=O)Nc1ccc(NC(=O)C(C)SCC(=O)Nc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C20H22FN3O3S/c1-3-18(25)22-16-8-10-17(11-9-16)24-20(27)13(2)28-12-19(26)23-15-6-4-14(21)5-7-15/h4-11,13H,3,12H2,1-2H3,(H,22,25)(H,23,26)(H,24,27) |
| InChIKey | NJOYVZGOSFXKJK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |