C20H21FN2O5S — CID 55709223
methyl 2-[4-[2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanoylamino]phenoxy]acetate (PubChem CID 55709223) has the molecular formula C20H21FN2O5S and a molecular weight of 420.46 g/mol. Its IUPAC name is methyl 2-[4-[2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanoylamino]phenoxy]acetate.
| Compound Name | methyl 2-[4-[2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanoylamino]phenoxy]acetate |
|---|---|
| PubChem CID | 55709223 |
| Molecular Formula | C20H21FN2O5S |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | methyl 2-[4-[2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanoylamino]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(NC(=O)C(C)SCC(=O)Nc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C20H21FN2O5S/c1-13(29-12-18(24)22-15-5-3-14(21)4-6-15)20(26)23-16-7-9-17(10-8-16)28-11-19(25)27-2/h3-10,13H,11-12H2,1-2H3,(H,22,24)(H,23,26) |
| InChIKey | WBGMVHDWBPSDHP-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |