C17H23FN2O4S — CID 119364211
(2R)-2-[2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanoylamino]-4-methylpentanoic acid (PubChem CID 119364211) has the molecular formula C17H23FN2O4S and a molecular weight of 370.45 g/mol. Its IUPAC name is (2R)-2-[2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanoylamino]-4-methylpentanoic acid.
| Compound Name | (2R)-2-[2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanoylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119364211 |
| Molecular Formula | C17H23FN2O4S |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | (2R)-2-[2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanoylamino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@@H](NC(=O)C(C)SCC(=O)Nc1ccc(F)cc1)C(=O)O |
| InChI | InChI=1S/C17H23FN2O4S/c1-10(2)8-14(17(23)24)20-16(22)11(3)25-9-15(21)19-13-6-4-12(18)5-7-13/h4-7,10-11,14H,8-9H2,1-3H3,(H,19,21)(H,20,22)(H,23,24)/t11?,14-/m1/s1 |
| InChIKey | HJCQGNDBKCBPMP-SBXXRYSUSA-N |
| XLogP | 2.50 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |