C21H25FN2O2S — CID 51157929
2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-N-(4-phenylbutan-2-yl)propanamide (PubChem CID 51157929) has the molecular formula C21H25FN2O2S and a molecular weight of 388.51 g/mol. Its IUPAC name is 2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-N-(4-phenylbutan-2-yl)propanamide.
| Compound Name | 2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-N-(4-phenylbutan-2-yl)propanamide |
|---|---|
| PubChem CID | 51157929 |
| Molecular Formula | C21H25FN2O2S |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-N-(4-phenylbutan-2-yl)propanamide |
| SMILES | CC(CCc1ccccc1)NC(=O)C(C)SCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C21H25FN2O2S/c1-15(8-9-17-6-4-3-5-7-17)23-21(26)16(2)27-14-20(25)24-19-12-10-18(22)11-13-19/h3-7,10-13,15-16H,8-9,14H2,1-2H3,(H,23,26)(H,24,25) |
| InChIKey | GYSQLBJEGCCVTF-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |