C23H28FN3O2S — CID 55683326
N-(1-benzylpiperidin-3-yl)-2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanamide (PubChem CID 55683326) has the molecular formula C23H28FN3O2S and a molecular weight of 429.56 g/mol. Its IUPAC name is N-(1-benzylpiperidin-3-yl)-2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanamide.
| Compound Name | N-(1-benzylpiperidin-3-yl)-2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanamide |
|---|---|
| PubChem CID | 55683326 |
| Molecular Formula | C23H28FN3O2S |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | N-(1-benzylpiperidin-3-yl)-2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanamide |
| SMILES | CC(SCC(=O)Nc1ccc(F)cc1)C(=O)NC1CCCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C23H28FN3O2S/c1-17(30-16-22(28)25-20-11-9-19(24)10-12-20)23(29)26-21-8-5-13-27(15-21)14-18-6-3-2-4-7-18/h2-4,6-7,9-12,17,21H,5,8,13-16H2,1H3,(H,25,28)(H,26,29) |
| InChIKey | WMPQKAQQNZOHEK-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |