C16H23ClFN3O2S — CID 119428204
2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-N-piperidin-3-ylpropanamide;hydrochloride (PubChem CID 119428204) has the molecular formula C16H23ClFN3O2S and a molecular weight of 375.90 g/mol. Its IUPAC name is 2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-N-piperidin-3-ylpropanamide;hydrochloride.
| Compound Name | 2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-N-piperidin-3-ylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 119428204 |
| Molecular Formula | C16H23ClFN3O2S |
| Molecular Weight | 375.90 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-N-piperidin-3-ylpropanamide;hydrochloride |
| SMILES | CC(SCC(=O)Nc1ccc(F)cc1)C(=O)NC1CCCNC1.Cl |
| InChI | InChI=1S/C16H22FN3O2S.ClH/c1-11(16(22)20-14-3-2-8-18-9-14)23-10-15(21)19-13-6-4-12(17)5-7-13;/h4-7,11,14,18H,2-3,8-10H2,1H3,(H,19,21)(H,20,22);1H |
| InChIKey | HGZCROUTCVJMPP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.90 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |