C21H24FN3O2S — CID 56580966
2-[1-(3-anilinopyrrolidin-1-yl)-1-oxopropan-2-yl]sulfanyl-N-(4-fluorophenyl)acetamide (PubChem CID 56580966) has the molecular formula C21H24FN3O2S and a molecular weight of 401.51 g/mol. Its IUPAC name is 2-[1-(3-anilinopyrrolidin-1-yl)-1-oxopropan-2-yl]sulfanyl-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[1-(3-anilinopyrrolidin-1-yl)-1-oxopropan-2-yl]sulfanyl-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 56580966 |
| Molecular Formula | C21H24FN3O2S |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 2-[1-(3-anilinopyrrolidin-1-yl)-1-oxopropan-2-yl]sulfanyl-N-(4-fluorophenyl)acetamide |
| SMILES | CC(SCC(=O)Nc1ccc(F)cc1)C(=O)N1CCC(Nc2ccccc2)C1 |
| InChI | InChI=1S/C21H24FN3O2S/c1-15(28-14-20(26)24-18-9-7-16(22)8-10-18)21(27)25-12-11-19(13-25)23-17-5-3-2-4-6-17/h2-10,15,19,23H,11-14H2,1H3,(H,24,26) |
| InChIKey | VCYAESRAAHDSAR-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |