C18H27N3O2S — CID 95300013
N-[(2S)-1-[(3R)-3-anilinopyrrolidin-1-yl]-4-methylsulfanyl-1-oxobutan-2-yl]propanamide (PubChem CID 95300013) has the molecular formula C18H27N3O2S and a molecular weight of 349.50 g/mol. Its IUPAC name is N-[(2S)-1-[(3R)-3-anilinopyrrolidin-1-yl]-4-methylsulfanyl-1-oxobutan-2-yl]propanamide.
| Compound Name | N-[(2S)-1-[(3R)-3-anilinopyrrolidin-1-yl]-4-methylsulfanyl-1-oxobutan-2-yl]propanamide |
|---|---|
| PubChem CID | 95300013 |
| Molecular Formula | C18H27N3O2S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | N-[(2S)-1-[(3R)-3-anilinopyrrolidin-1-yl]-4-methylsulfanyl-1-oxobutan-2-yl]propanamide |
| SMILES | CCC(=O)N[C@@H](CCSC)C(=O)N1CC[C@@H](Nc2ccccc2)C1 |
| InChI | InChI=1S/C18H27N3O2S/c1-3-17(22)20-16(10-12-24-2)18(23)21-11-9-15(13-21)19-14-7-5-4-6-8-14/h4-8,15-16,19H,3,9-13H2,1-2H3,(H,20,22)/t15-,16+/m1/s1 |
| InChIKey | XWNXFBHDDRWJRD-CVEARBPZSA-N |
| XLogP | 2.35 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |