C21H29FN2O2S — CID 55675683
N-(4-fluorophenyl)-2-[1-(4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-1-oxopropan-2-yl]sulfanylacetamide (PubChem CID 55675683) has the molecular formula C21H29FN2O2S and a molecular weight of 392.54 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[1-(4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-1-oxopropan-2-yl]sulfanylacetamide.
| Compound Name | N-(4-fluorophenyl)-2-[1-(4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-1-oxopropan-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 55675683 |
| Molecular Formula | C21H29FN2O2S |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | N-(4-fluorophenyl)-2-[1-(4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-1-oxopropan-2-yl]sulfanylacetamide |
| SMILES | CC(SCC(=O)Nc1ccc(F)cc1)C(=O)N1CCC(C)C2CCCCC21 |
| InChI | InChI=1S/C21H29FN2O2S/c1-14-11-12-24(19-6-4-3-5-18(14)19)21(26)15(2)27-13-20(25)23-17-9-7-16(22)8-10-17/h7-10,14-15,18-19H,3-6,11-13H2,1-2H3,(H,23,25) |
| InChIKey | UFZDQYPLSHDVHA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |