C14H17FN2O4S — CID 7892847
[(2S)-1-amino-1-oxopropan-2-yl] (2S)-2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanoate (PubChem CID 7892847) has the molecular formula C14H17FN2O4S and a molecular weight of 328.37 g/mol. Its IUPAC name is [(2S)-1-amino-1-oxopropan-2-yl] (2S)-2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanoate.
| Compound Name | [(2S)-1-amino-1-oxopropan-2-yl] (2S)-2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 7892847 |
| Molecular Formula | C14H17FN2O4S |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | [(2S)-1-amino-1-oxopropan-2-yl] (2S)-2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanoate |
| SMILES | C[C@H](OC(=O)[C@H](C)SCC(=O)Nc1ccc(F)cc1)C(N)=O |
| InChI | InChI=1S/C14H17FN2O4S/c1-8(13(16)19)21-14(20)9(2)22-7-12(18)17-11-5-3-10(15)4-6-11/h3-6,8-9H,7H2,1-2H3,(H2,16,19)(H,17,18)/t8-,9-/m0/s1 |
| InChIKey | REIJSFIRBVJIHM-IUCAKERBSA-N |
| XLogP | 1.30 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |