C17H15F2NO3S — CID 78776955
(2-fluorophenyl) 2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanoate (PubChem CID 78776955) has the molecular formula C17H15F2NO3S and a molecular weight of 351.37 g/mol. Its IUPAC name is (2-fluorophenyl) 2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanoate.
| Compound Name | (2-fluorophenyl) 2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 78776955 |
| Molecular Formula | C17H15F2NO3S |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | (2-fluorophenyl) 2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanoate |
| SMILES | CC(SCC(=O)Nc1ccc(F)cc1)C(=O)Oc1ccccc1F |
| InChI | InChI=1S/C17H15F2NO3S/c1-11(17(22)23-15-5-3-2-4-14(15)19)24-10-16(21)20-13-8-6-12(18)7-9-13/h2-9,11H,10H2,1H3,(H,20,21) |
| InChIKey | INVQPYGHQXUXCQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|