C15H19FN2O4S — CID 7892752
[2-(dimethylamino)-2-oxoethyl] (2S)-2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanoate (PubChem CID 7892752) has the molecular formula C15H19FN2O4S and a molecular weight of 342.39 g/mol. Its IUPAC name is [2-(dimethylamino)-2-oxoethyl] (2S)-2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanoate.
| Compound Name | [2-(dimethylamino)-2-oxoethyl] (2S)-2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 7892752 |
| Molecular Formula | C15H19FN2O4S |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | [2-(dimethylamino)-2-oxoethyl] (2S)-2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanoate |
| SMILES | C[C@H](SCC(=O)Nc1ccc(F)cc1)C(=O)OCC(=O)N(C)C |
| InChI | InChI=1S/C15H19FN2O4S/c1-10(15(21)22-8-14(20)18(2)3)23-9-13(19)17-12-6-4-11(16)5-7-12/h4-7,10H,8-9H2,1-3H3,(H,17,19)/t10-/m0/s1 |
| InChIKey | ROTZGGQDCNGYCG-JTQLQIEISA-N |
| XLogP | 1.52 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |