C20H29FN2O3S — CID 51222306
N-(3-cyclohexyloxypropyl)-2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanamide (PubChem CID 51222306) has the molecular formula C20H29FN2O3S and a molecular weight of 396.53 g/mol. Its IUPAC name is N-(3-cyclohexyloxypropyl)-2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanamide.
| Compound Name | N-(3-cyclohexyloxypropyl)-2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanamide |
|---|---|
| PubChem CID | 51222306 |
| Molecular Formula | C20H29FN2O3S |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | N-(3-cyclohexyloxypropyl)-2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanamide |
| SMILES | CC(SCC(=O)Nc1ccc(F)cc1)C(=O)NCCCOC1CCCCC1 |
| InChI | InChI=1S/C20H29FN2O3S/c1-15(27-14-19(24)23-17-10-8-16(21)9-11-17)20(25)22-12-5-13-26-18-6-3-2-4-7-18/h8-11,15,18H,2-7,12-14H2,1H3,(H,22,25)(H,23,24) |
| InChIKey | ZYXAXRMXHDWGHB-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|