C21H25F2N3O2S — CID 55907635
2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-N-[3-(2-fluoro-N-methylanilino)propyl]propanamide (PubChem CID 55907635) has the molecular formula C21H25F2N3O2S and a molecular weight of 421.51 g/mol. Its IUPAC name is 2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-N-[3-(2-fluoro-N-methylanilino)propyl]propanamide.
| Compound Name | 2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-N-[3-(2-fluoro-N-methylanilino)propyl]propanamide |
|---|---|
| PubChem CID | 55907635 |
| Molecular Formula | C21H25F2N3O2S |
| Molecular Weight | 421.51 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-N-[3-(2-fluoro-N-methylanilino)propyl]propanamide |
| SMILES | CC(SCC(=O)Nc1ccc(F)cc1)C(=O)NCCCN(C)c1ccccc1F |
| InChI | InChI=1S/C21H25F2N3O2S/c1-15(29-14-20(27)25-17-10-8-16(22)9-11-17)21(28)24-12-5-13-26(2)19-7-4-3-6-18(19)23/h3-4,6-11,15H,5,12-14H2,1-2H3,(H,24,28)(H,25,27) |
| InChIKey | GKBAWRHVSIXEJC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.51 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|