C23H30FN3O2S — CID 55336212
N-[2-(diethylamino)-2-phenylethyl]-2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanamide (PubChem CID 55336212) has the molecular formula C23H30FN3O2S and a molecular weight of 431.58 g/mol. Its IUPAC name is N-[2-(diethylamino)-2-phenylethyl]-2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanamide.
| Compound Name | N-[2-(diethylamino)-2-phenylethyl]-2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanamide |
|---|---|
| PubChem CID | 55336212 |
| Molecular Formula | C23H30FN3O2S |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | N-[2-(diethylamino)-2-phenylethyl]-2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanamide |
| SMILES | CCN(CC)C(CNC(=O)C(C)SCC(=O)Nc1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H30FN3O2S/c1-4-27(5-2)21(18-9-7-6-8-10-18)15-25-23(29)17(3)30-16-22(28)26-20-13-11-19(24)12-14-20/h6-14,17,21H,4-5,15-16H2,1-3H3,(H,25,29)(H,26,28) |
| InChIKey | ZOSDVGBTCRKBHA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |