C19H23F2N3O — CID 51579414
1-[(2R)-2-(diethylamino)-2-phenylethyl]-3-(2,4-difluorophenyl)urea (PubChem CID 51579414) has the molecular formula C19H23F2N3O and a molecular weight of 347.41 g/mol. Its IUPAC name is 1-[(2R)-2-(diethylamino)-2-phenylethyl]-3-(2,4-difluorophenyl)urea.
| Compound Name | 1-[(2R)-2-(diethylamino)-2-phenylethyl]-3-(2,4-difluorophenyl)urea |
|---|---|
| PubChem CID | 51579414 |
| Molecular Formula | C19H23F2N3O |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 1-[(2R)-2-(diethylamino)-2-phenylethyl]-3-(2,4-difluorophenyl)urea |
| SMILES | CCN(CC)[C@@H](CNC(=O)Nc1ccc(F)cc1F)c1ccccc1 |
| InChI | InChI=1S/C19H23F2N3O/c1-3-24(4-2)18(14-8-6-5-7-9-14)13-22-19(25)23-17-11-10-15(20)12-16(17)21/h5-12,18H,3-4,13H2,1-2H3,(H2,22,23,25)/t18-/m0/s1 |
| InChIKey | ITWRHJPFYUJFSK-SFHVURJKSA-N |
| XLogP | 4.17 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |