C16H16F2N2O2 — CID 46494085
1-(2,4-difluorophenyl)-3-[2-hydroxy-2-(4-methylphenyl)ethyl]urea (PubChem CID 46494085) has the molecular formula C16H16F2N2O2 and a molecular weight of 306.31 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-[2-hydroxy-2-(4-methylphenyl)ethyl]urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-[2-hydroxy-2-(4-methylphenyl)ethyl]urea |
|---|---|
| PubChem CID | 46494085 |
| Molecular Formula | C16H16F2N2O2 |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-[2-hydroxy-2-(4-methylphenyl)ethyl]urea |
| SMILES | Cc1ccc(C(O)CNC(=O)Nc2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C16H16F2N2O2/c1-10-2-4-11(5-3-10)15(21)9-19-16(22)20-14-7-6-12(17)8-13(14)18/h2-8,15,21H,9H2,1H3,(H2,19,20,22) |
| InChIKey | FILWFLYKHGMVMV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |