C10H11F2N3O3 — CID 107258525
3-[(2,4-difluorophenyl)carbamoylamino]-2-hydroxypropanamide (PubChem CID 107258525) has the molecular formula C10H11F2N3O3 and a molecular weight of 259.21 g/mol. Its IUPAC name is 3-[(2,4-difluorophenyl)carbamoylamino]-2-hydroxypropanamide.
| Compound Name | 3-[(2,4-difluorophenyl)carbamoylamino]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 107258525 |
| Molecular Formula | C10H11F2N3O3 |
| Molecular Weight | 259.21 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 3-[(2,4-difluorophenyl)carbamoylamino]-2-hydroxypropanamide |
| SMILES | NC(=O)C(O)CNC(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C10H11F2N3O3/c11-5-1-2-7(6(12)3-5)15-10(18)14-4-8(16)9(13)17/h1-3,8,16H,4H2,(H2,13,17)(H2,14,15,18) |
| InChIKey | QWPGOUMXCYWWLA-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.21 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |