C9H9F2N3O3 — CID 113351033
2-[(2,4-difluorophenyl)carbamoylamino]oxyacetamide (PubChem CID 113351033) has the molecular formula C9H9F2N3O3 and a molecular weight of 245.18 g/mol. Its IUPAC name is 2-[(2,4-difluorophenyl)carbamoylamino]oxyacetamide.
| Compound Name | 2-[(2,4-difluorophenyl)carbamoylamino]oxyacetamide |
|---|---|
| PubChem CID | 113351033 |
| Molecular Formula | C9H9F2N3O3 |
| Molecular Weight | 245.18 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 2-[(2,4-difluorophenyl)carbamoylamino]oxyacetamide |
| SMILES | NC(=O)CONC(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C9H9F2N3O3/c10-5-1-2-7(6(11)3-5)13-9(16)14-17-4-8(12)15/h1-3H,4H2,(H2,12,15)(H2,13,14,16) |
| InChIKey | UCBXGUAFBWIYJC-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.18 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|