C11H13F2N3OS — CID 61118848
1-(1-amino-2-methyl-1-sulfanylidenepropan-2-yl)-3-(2,4-difluorophenyl)urea (PubChem CID 61118848) has the molecular formula C11H13F2N3OS and a molecular weight of 273.31 g/mol. Its IUPAC name is 1-(1-amino-2-methyl-1-sulfanylidenepropan-2-yl)-3-(2,4-difluorophenyl)urea.
| Compound Name | 1-(1-amino-2-methyl-1-sulfanylidenepropan-2-yl)-3-(2,4-difluorophenyl)urea |
|---|---|
| PubChem CID | 61118848 |
| Molecular Formula | C11H13F2N3OS |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 1-(1-amino-2-methyl-1-sulfanylidenepropan-2-yl)-3-(2,4-difluorophenyl)urea |
| SMILES | CC(C)(NC(=O)Nc1ccc(F)cc1F)C(N)=S |
| InChI | InChI=1S/C11H13F2N3OS/c1-11(2,9(14)18)16-10(17)15-8-4-3-6(12)5-7(8)13/h3-5H,1-2H3,(H2,14,18)(H2,15,16,17) |
| InChIKey | IHHKKZBCKFEMLN-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|