C8H5F2NO2 — CID 115165918
N-(2,4-difluorophenyl)-2-oxoacetamide (PubChem CID 115165918) has the molecular formula C8H5F2NO2 and a molecular weight of 185.13 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-oxoacetamide.
| Compound Name | N-(2,4-difluorophenyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 115165918 |
| Molecular Formula | C8H5F2NO2 |
| Molecular Weight | 185.13 g/mol |
| Exact Mass | 185.03 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-oxoacetamide |
| SMILES | O=CC(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C8H5F2NO2/c9-5-1-2-7(6(10)3-5)11-8(13)4-12/h1-4H,(H,11,13) |
| InChIKey | MNZNYIQXGSYGSB-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.13 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|