C14H11F3N2O — CID 17263659
1-(2,4-difluorophenyl)-3-(4-fluoro-2-methylphenyl)urea (PubChem CID 17263659) has the molecular formula C14H11F3N2O and a molecular weight of 280.25 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-(4-fluoro-2-methylphenyl)urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-(4-fluoro-2-methylphenyl)urea |
|---|---|
| PubChem CID | 17263659 |
| Molecular Formula | C14H11F3N2O |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-(4-fluoro-2-methylphenyl)urea |
| SMILES | Cc1cc(F)ccc1NC(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C14H11F3N2O/c1-8-6-9(15)2-4-12(8)18-14(20)19-13-5-3-10(16)7-11(13)17/h2-7H,1H3,(H2,18,19,20) |
| InChIKey | YINMOIUCQJYGAU-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |