C15H12F2N2O3 — CID 1297024
3-[(2,4-difluorophenyl)carbamoylamino]-4-methylbenzoic acid (PubChem CID 1297024) has the molecular formula C15H12F2N2O3 and a molecular weight of 306.27 g/mol. Its IUPAC name is 3-[(2,4-difluorophenyl)carbamoylamino]-4-methylbenzoic acid.
| Compound Name | 3-[(2,4-difluorophenyl)carbamoylamino]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 1297024 |
| Molecular Formula | C15H12F2N2O3 |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 3-[(2,4-difluorophenyl)carbamoylamino]-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1NC(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C15H12F2N2O3/c1-8-2-3-9(14(20)21)6-13(8)19-15(22)18-12-5-4-10(16)7-11(12)17/h2-7H,1H3,(H,20,21)(H2,18,19,22) |
| InChIKey | FUOYJOHIIKHTFH-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |