C11H12ClFN2O2 — CID 43146314
2-chloro-N-[(4-fluoro-2-methylphenyl)carbamoyl]propanamide (PubChem CID 43146314) has the molecular formula C11H12ClFN2O2 and a molecular weight of 258.68 g/mol. Its IUPAC name is 2-chloro-N-[(4-fluoro-2-methylphenyl)carbamoyl]propanamide.
| Compound Name | 2-chloro-N-[(4-fluoro-2-methylphenyl)carbamoyl]propanamide |
|---|---|
| PubChem CID | 43146314 |
| Molecular Formula | C11H12ClFN2O2 |
| Molecular Weight | 258.68 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 2-chloro-N-[(4-fluoro-2-methylphenyl)carbamoyl]propanamide |
| SMILES | Cc1cc(F)ccc1NC(=O)NC(=O)C(C)Cl |
| InChI | InChI=1S/C11H12ClFN2O2/c1-6-5-8(13)3-4-9(6)14-11(17)15-10(16)7(2)12/h3-5,7H,1-2H3,(H2,14,15,16,17) |
| InChIKey | ALSMAJUQTXIXMP-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.68 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|