C12H15FN2O2 — CID 47147961
N-(4-fluoro-2-methylphenyl)-N'-propan-2-yloxamide (PubChem CID 47147961) has the molecular formula C12H15FN2O2 and a molecular weight of 238.26 g/mol. Its IUPAC name is N-(4-fluoro-2-methylphenyl)-N'-propan-2-yloxamide.
| Compound Name | N-(4-fluoro-2-methylphenyl)-N'-propan-2-yloxamide |
|---|---|
| PubChem CID | 47147961 |
| Molecular Formula | C12H15FN2O2 |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | N-(4-fluoro-2-methylphenyl)-N'-propan-2-yloxamide |
| SMILES | Cc1cc(F)ccc1NC(=O)C(=O)NC(C)C |
| InChI | InChI=1S/C12H15FN2O2/c1-7(2)14-11(16)12(17)15-10-5-4-9(13)6-8(10)3/h4-7H,1-3H3,(H,14,16)(H,15,17) |
| InChIKey | QBJDYMACNKTKNS-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|