C18H19FN2O4 — CID 95299337
N-(4-fluoro-2-methylphenyl)-N'-[(1R)-1-(2-hydroxy-5-methoxyphenyl)ethyl]oxamide (PubChem CID 95299337) has the molecular formula C18H19FN2O4 and a molecular weight of 346.36 g/mol. Its IUPAC name is N-(4-fluoro-2-methylphenyl)-N'-[(1R)-1-(2-hydroxy-5-methoxyphenyl)ethyl]oxamide.
| Compound Name | N-(4-fluoro-2-methylphenyl)-N'-[(1R)-1-(2-hydroxy-5-methoxyphenyl)ethyl]oxamide |
|---|---|
| PubChem CID | 95299337 |
| Molecular Formula | C18H19FN2O4 |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | N-(4-fluoro-2-methylphenyl)-N'-[(1R)-1-(2-hydroxy-5-methoxyphenyl)ethyl]oxamide |
| SMILES | COc1ccc(O)c([C@@H](C)NC(=O)C(=O)Nc2ccc(F)cc2C)c1 |
| InChI | InChI=1S/C18H19FN2O4/c1-10-8-12(19)4-6-15(10)21-18(24)17(23)20-11(2)14-9-13(25-3)5-7-16(14)22/h4-9,11,22H,1-3H3,(H,20,23)(H,21,24)/t11-/m1/s1 |
| InChIKey | SIIGYRBXHGZYPP-LLVKDONJSA-N |
| XLogP | 2.66 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|