C18H20N2O5 — CID 95977791
N'-[(1S)-1-(2-hydroxy-5-methoxyphenyl)ethyl]-N-(3-methoxyphenyl)oxamide (PubChem CID 95977791) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is N'-[(1S)-1-(2-hydroxy-5-methoxyphenyl)ethyl]-N-(3-methoxyphenyl)oxamide.
| Compound Name | N'-[(1S)-1-(2-hydroxy-5-methoxyphenyl)ethyl]-N-(3-methoxyphenyl)oxamide |
|---|---|
| PubChem CID | 95977791 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | N'-[(1S)-1-(2-hydroxy-5-methoxyphenyl)ethyl]-N-(3-methoxyphenyl)oxamide |
| SMILES | COc1cccc(NC(=O)C(=O)N[C@@H](C)c2cc(OC)ccc2O)c1 |
| InChI | InChI=1S/C18H20N2O5/c1-11(15-10-14(25-3)7-8-16(15)21)19-17(22)18(23)20-12-5-4-6-13(9-12)24-2/h4-11,21H,1-3H3,(H,19,22)(H,20,23)/t11-/m0/s1 |
| InChIKey | JWDSMUWBKDYKRC-NSHDSACASA-N |
| XLogP | 2.23 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|