C17H17FN2O4 — CID 95572852
N-(2-fluorophenyl)-N'-[(1R)-1-(2-hydroxy-5-methoxyphenyl)ethyl]oxamide (PubChem CID 95572852) has the molecular formula C17H17FN2O4 and a molecular weight of 332.33 g/mol. Its IUPAC name is N-(2-fluorophenyl)-N'-[(1R)-1-(2-hydroxy-5-methoxyphenyl)ethyl]oxamide.
| Compound Name | N-(2-fluorophenyl)-N'-[(1R)-1-(2-hydroxy-5-methoxyphenyl)ethyl]oxamide |
|---|---|
| PubChem CID | 95572852 |
| Molecular Formula | C17H17FN2O4 |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | N-(2-fluorophenyl)-N'-[(1R)-1-(2-hydroxy-5-methoxyphenyl)ethyl]oxamide |
| SMILES | COc1ccc(O)c([C@@H](C)NC(=O)C(=O)Nc2ccccc2F)c1 |
| InChI | InChI=1S/C17H17FN2O4/c1-10(12-9-11(24-2)7-8-15(12)21)19-16(22)17(23)20-14-6-4-3-5-13(14)18/h3-10,21H,1-2H3,(H,19,22)(H,20,23)/t10-/m1/s1 |
| InChIKey | SICXUOOQNUNDSJ-SNVBAGLBSA-N |
| XLogP | 2.36 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|