C11H13FN2O3 — CID 47228940
N-(2-fluorophenyl)-N'-(1-hydroxypropan-2-yl)oxamide (PubChem CID 47228940) has the molecular formula C11H13FN2O3 and a molecular weight of 240.23 g/mol. Its IUPAC name is N-(2-fluorophenyl)-N'-(1-hydroxypropan-2-yl)oxamide.
| Compound Name | N-(2-fluorophenyl)-N'-(1-hydroxypropan-2-yl)oxamide |
|---|---|
| PubChem CID | 47228940 |
| Molecular Formula | C11H13FN2O3 |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | N-(2-fluorophenyl)-N'-(1-hydroxypropan-2-yl)oxamide |
| SMILES | CC(CO)NC(=O)C(=O)Nc1ccccc1F |
| InChI | InChI=1S/C11H13FN2O3/c1-7(6-15)13-10(16)11(17)14-9-5-3-2-4-8(9)12/h2-5,7,15H,6H2,1H3,(H,13,16)(H,14,17) |
| InChIKey | PBTZWRLGTYWVPC-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|