C11H11ClF2N2O3 — CID 111629756
N-(2-chloro-4,5-difluorophenyl)-N'-(1-hydroxypropan-2-yl)oxamide (PubChem CID 111629756) has the molecular formula C11H11ClF2N2O3 and a molecular weight of 292.67 g/mol. Its IUPAC name is N-(2-chloro-4,5-difluorophenyl)-N'-(1-hydroxypropan-2-yl)oxamide.
| Compound Name | N-(2-chloro-4,5-difluorophenyl)-N'-(1-hydroxypropan-2-yl)oxamide |
|---|---|
| PubChem CID | 111629756 |
| Molecular Formula | C11H11ClF2N2O3 |
| Molecular Weight | 292.67 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | N-(2-chloro-4,5-difluorophenyl)-N'-(1-hydroxypropan-2-yl)oxamide |
| SMILES | CC(CO)NC(=O)C(=O)Nc1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C11H11ClF2N2O3/c1-5(4-17)15-10(18)11(19)16-9-3-8(14)7(13)2-6(9)12/h2-3,5,17H,4H2,1H3,(H,15,18)(H,16,19) |
| InChIKey | CTLYZYPJMXBMMW-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.67 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|