C15H22N2O3 — CID 47228973
N-(2-tert-butylphenyl)-N'-(1-hydroxypropan-2-yl)oxamide (PubChem CID 47228973) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is N-(2-tert-butylphenyl)-N'-(1-hydroxypropan-2-yl)oxamide.
| Compound Name | N-(2-tert-butylphenyl)-N'-(1-hydroxypropan-2-yl)oxamide |
|---|---|
| PubChem CID | 47228973 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | N-(2-tert-butylphenyl)-N'-(1-hydroxypropan-2-yl)oxamide |
| SMILES | CC(CO)NC(=O)C(=O)Nc1ccccc1C(C)(C)C |
| InChI | InChI=1S/C15H22N2O3/c1-10(9-18)16-13(19)14(20)17-12-8-6-5-7-11(12)15(2,3)4/h5-8,10,18H,9H2,1-4H3,(H,16,19)(H,17,20) |
| InChIKey | KLSMLBKUVCZRRV-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|