C12H15FN2O3 — CID 111521413
N-(3-fluoro-2-methylphenyl)-N'-(1-hydroxypropan-2-yl)oxamide (PubChem CID 111521413) has the molecular formula C12H15FN2O3 and a molecular weight of 254.26 g/mol. Its IUPAC name is N-(3-fluoro-2-methylphenyl)-N'-(1-hydroxypropan-2-yl)oxamide.
| Compound Name | N-(3-fluoro-2-methylphenyl)-N'-(1-hydroxypropan-2-yl)oxamide |
|---|---|
| PubChem CID | 111521413 |
| Molecular Formula | C12H15FN2O3 |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | N-(3-fluoro-2-methylphenyl)-N'-(1-hydroxypropan-2-yl)oxamide |
| SMILES | Cc1c(F)cccc1NC(=O)C(=O)NC(C)CO |
| InChI | InChI=1S/C12H15FN2O3/c1-7(6-16)14-11(17)12(18)15-10-5-3-4-9(13)8(10)2/h3-5,7,16H,6H2,1-2H3,(H,14,17)(H,15,18) |
| InChIKey | CUBFEZWSUGOWQN-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|