C23H37N3O5 — CID 58635218
N-(2-tert-butylphenyl)-N'-[(2S)-1-[[(2S)-1,1-diethoxybutan-2-yl]amino]-1-oxopropan-2-yl]oxamide (PubChem CID 58635218) has the molecular formula C23H37N3O5 and a molecular weight of 435.57 g/mol. Its IUPAC name is N-(2-tert-butylphenyl)-N'-[(2S)-1-[[(2S)-1,1-diethoxybutan-2-yl]amino]-1-oxopropan-2-yl]oxamide.
| Compound Name | N-(2-tert-butylphenyl)-N'-[(2S)-1-[[(2S)-1,1-diethoxybutan-2-yl]amino]-1-oxopropan-2-yl]oxamide |
|---|---|
| PubChem CID | 58635218 |
| Molecular Formula | C23H37N3O5 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.27 |
| IUPAC Name | N-(2-tert-butylphenyl)-N'-[(2S)-1-[[(2S)-1,1-diethoxybutan-2-yl]amino]-1-oxopropan-2-yl]oxamide |
| SMILES | CCOC(OCC)[C@H](CC)NC(=O)[C@H](C)NC(=O)C(=O)Nc1ccccc1C(C)(C)C |
| InChI | InChI=1S/C23H37N3O5/c1-8-17(22(30-9-2)31-10-3)25-19(27)15(4)24-20(28)21(29)26-18-14-12-11-13-16(18)23(5,6)7/h11-15,17,22H,8-10H2,1-7H3,(H,24,28)(H,25,27)(H,26,29)/t15-,17-/m0/s1 |
| InChIKey | MTQZXXVRXMAZLH-RDJZCZTQSA-N |
| XLogP | 2.72 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|