C21H29N3O6 — CID 22134588
N-(2-tert-butylphenyl)-N'-[1-[(2-ethoxy-5-oxooxolan-3-yl)amino]-1-oxopropan-2-yl]oxamide (PubChem CID 22134588) has the molecular formula C21H29N3O6 and a molecular weight of 419.48 g/mol. Its IUPAC name is N-(2-tert-butylphenyl)-N'-[1-[(2-ethoxy-5-oxooxolan-3-yl)amino]-1-oxopropan-2-yl]oxamide.
| Compound Name | N-(2-tert-butylphenyl)-N'-[1-[(2-ethoxy-5-oxooxolan-3-yl)amino]-1-oxopropan-2-yl]oxamide |
|---|---|
| PubChem CID | 22134588 |
| Molecular Formula | C21H29N3O6 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | N-(2-tert-butylphenyl)-N'-[1-[(2-ethoxy-5-oxooxolan-3-yl)amino]-1-oxopropan-2-yl]oxamide |
| SMILES | CCOC1OC(=O)CC1NC(=O)C(C)NC(=O)C(=O)Nc1ccccc1C(C)(C)C |
| InChI | InChI=1S/C21H29N3O6/c1-6-29-20-15(11-16(25)30-20)24-17(26)12(2)22-18(27)19(28)23-14-10-8-7-9-13(14)21(3,4)5/h7-10,12,15,20H,6,11H2,1-5H3,(H,22,27)(H,23,28)(H,24,26) |
| InChIKey | VMXRVTVPEZRZMJ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|