C19H28N2O2 — CID 124605766
N'-(2-tert-butylphenyl)-N-[(1R,2R)-2-methylcyclohexyl]oxamide (PubChem CID 124605766) has the molecular formula C19H28N2O2 and a molecular weight of 316.44 g/mol. Its IUPAC name is N'-(2-tert-butylphenyl)-N-[(1R,2R)-2-methylcyclohexyl]oxamide.
| Compound Name | N'-(2-tert-butylphenyl)-N-[(1R,2R)-2-methylcyclohexyl]oxamide |
|---|---|
| PubChem CID | 124605766 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | N'-(2-tert-butylphenyl)-N-[(1R,2R)-2-methylcyclohexyl]oxamide |
| SMILES | C[C@@H]1CCCC[C@H]1NC(=O)C(=O)Nc1ccccc1C(C)(C)C |
| InChI | InChI=1S/C19H28N2O2/c1-13-9-5-7-11-15(13)20-17(22)18(23)21-16-12-8-6-10-14(16)19(2,3)4/h6,8,10,12-13,15H,5,7,9,11H2,1-4H3,(H,20,22)(H,21,23)/t13-,15-/m1/s1 |
| InChIKey | YQKZEGUAPCNVOS-UKRRQHHQSA-N |
| XLogP | 3.62 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|