C16H28N2O6 — CID 70803855
tert-butyl N-[(2S)-1-[[(3S)-2-butoxy-5-oxooxolan-3-yl]amino]-1-oxopropan-2-yl]carbamate (PubChem CID 70803855) has the molecular formula C16H28N2O6 and a molecular weight of 344.41 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[[(3S)-2-butoxy-5-oxooxolan-3-yl]amino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[[(3S)-2-butoxy-5-oxooxolan-3-yl]amino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 70803855 |
| Molecular Formula | C16H28N2O6 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | tert-butyl N-[(2S)-1-[[(3S)-2-butoxy-5-oxooxolan-3-yl]amino]-1-oxopropan-2-yl]carbamate |
| SMILES | CCCCOC1OC(=O)C[C@@H]1NC(=O)[C@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H28N2O6/c1-6-7-8-22-14-11(9-12(19)23-14)18-13(20)10(2)17-15(21)24-16(3,4)5/h10-11,14H,6-9H2,1-5H3,(H,17,21)(H,18,20)/t10-,11-,14?/m0/s1 |
| InChIKey | COQVYEUREIGYLO-RFMBEDMFSA-N |
| XLogP | 1.47 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|