C14H18Cl2N2O3 — CID 111798057
N-(2,4-dichlorophenyl)-N'-(1-hydroxy-4-methylpentan-2-yl)oxamide (PubChem CID 111798057) has the molecular formula C14H18Cl2N2O3 and a molecular weight of 333.22 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-N'-(1-hydroxy-4-methylpentan-2-yl)oxamide.
| Compound Name | N-(2,4-dichlorophenyl)-N'-(1-hydroxy-4-methylpentan-2-yl)oxamide |
|---|---|
| PubChem CID | 111798057 |
| Molecular Formula | C14H18Cl2N2O3 |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | N-(2,4-dichlorophenyl)-N'-(1-hydroxy-4-methylpentan-2-yl)oxamide |
| SMILES | CC(C)CC(CO)NC(=O)C(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H18Cl2N2O3/c1-8(2)5-10(7-19)17-13(20)14(21)18-12-4-3-9(15)6-11(12)16/h3-4,6,8,10,19H,5,7H2,1-2H3,(H,17,20)(H,18,21) |
| InChIKey | MZELMLXLGMTXNJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|