C11H12Cl2N2O2 — CID 2988512
N-(2,5-dichlorophenyl)-N'-propan-2-yloxamide (PubChem CID 2988512) has the molecular formula C11H12Cl2N2O2 and a molecular weight of 275.13 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-N'-propan-2-yloxamide.
| Compound Name | N-(2,5-dichlorophenyl)-N'-propan-2-yloxamide |
|---|---|
| PubChem CID | 2988512 |
| Molecular Formula | C11H12Cl2N2O2 |
| Molecular Weight | 275.13 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | N-(2,5-dichlorophenyl)-N'-propan-2-yloxamide |
| SMILES | CC(C)NC(=O)C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H12Cl2N2O2/c1-6(2)14-10(16)11(17)15-9-5-7(12)3-4-8(9)13/h3-6H,1-2H3,(H,14,16)(H,15,17) |
| InChIKey | IWNALQAPCGJGGL-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.13 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|