C16H13Cl2N3O3 — CID 108501018
N-(3-acetamidophenyl)-N'-(2,5-dichlorophenyl)oxamide (PubChem CID 108501018) has the molecular formula C16H13Cl2N3O3 and a molecular weight of 366.20 g/mol. Its IUPAC name is N-(3-acetamidophenyl)-N'-(2,5-dichlorophenyl)oxamide.
| Compound Name | N-(3-acetamidophenyl)-N'-(2,5-dichlorophenyl)oxamide |
|---|---|
| PubChem CID | 108501018 |
| Molecular Formula | C16H13Cl2N3O3 |
| Molecular Weight | 366.20 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | N-(3-acetamidophenyl)-N'-(2,5-dichlorophenyl)oxamide |
| SMILES | CC(=O)Nc1cccc(NC(=O)C(=O)Nc2cc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C16H13Cl2N3O3/c1-9(22)19-11-3-2-4-12(8-11)20-15(23)16(24)21-14-7-10(17)5-6-13(14)18/h2-8H,1H3,(H,19,22)(H,20,23)(H,21,24) |
| InChIKey | FLUYLFLNUWPOQS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.20 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|