C14H9Cl3N2O2 — CID 108516544
N-(3-chlorophenyl)-N'-(3,5-dichlorophenyl)oxamide (PubChem CID 108516544) has the molecular formula C14H9Cl3N2O2 and a molecular weight of 343.60 g/mol. Its IUPAC name is N-(3-chlorophenyl)-N'-(3,5-dichlorophenyl)oxamide.
| Compound Name | N-(3-chlorophenyl)-N'-(3,5-dichlorophenyl)oxamide |
|---|---|
| PubChem CID | 108516544 |
| Molecular Formula | C14H9Cl3N2O2 |
| Molecular Weight | 343.60 g/mol |
| Exact Mass | 341.97 |
| IUPAC Name | N-(3-chlorophenyl)-N'-(3,5-dichlorophenyl)oxamide |
| SMILES | O=C(Nc1cccc(Cl)c1)C(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C14H9Cl3N2O2/c15-8-2-1-3-11(5-8)18-13(20)14(21)19-12-6-9(16)4-10(17)7-12/h1-7H,(H,18,20)(H,19,21) |
| InChIKey | YFCWTAQMXZJFQT-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.60 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|