C20H15Cl2N3O2 — CID 108525447
N-(4-anilinophenyl)-N'-(3,5-dichlorophenyl)oxamide (PubChem CID 108525447) has the molecular formula C20H15Cl2N3O2 and a molecular weight of 400.27 g/mol. Its IUPAC name is N-(4-anilinophenyl)-N'-(3,5-dichlorophenyl)oxamide.
| Compound Name | N-(4-anilinophenyl)-N'-(3,5-dichlorophenyl)oxamide |
|---|---|
| PubChem CID | 108525447 |
| Molecular Formula | C20H15Cl2N3O2 |
| Molecular Weight | 400.27 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | N-(4-anilinophenyl)-N'-(3,5-dichlorophenyl)oxamide |
| SMILES | O=C(Nc1ccc(Nc2ccccc2)cc1)C(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C20H15Cl2N3O2/c21-13-10-14(22)12-18(11-13)25-20(27)19(26)24-17-8-6-16(7-9-17)23-15-4-2-1-3-5-15/h1-12,23H,(H,24,26)(H,25,27) |
| InChIKey | CCDZUYRDYMVEPU-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.27 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|